| Name | butyl 4-hydroxybenzoate sodium salt |
| Synonyms | ButylParabenSodium Sodium Butylparaben Butylparaben sodium salt BUTYL4-HYDROXYBENZOATESODIUM Sodium Butyl P-Hydroxybenzoate Butyl P-hydroxybenzoate sodium SODIUMBUTYLPARA-HYDROXYBENZOATE Butyl-4-hydroxybenzoatsodiumsalt sodium 4-(butoxycarbonyl)phenolate butyl 4-hydroxybenzoate sodium salt BUTYL 4-HYDROXYBENZOATE SODIUM SALT 4-(Sodiooxy)benzoic acid butyl ester Benzoic acid, 4-hydroxy-, butyl ester, sodium salt BUTYL4-HYDROXYBENZOATESODIUM(BUTYLPARABENSODIUMSALT) |
| CAS | 36457-20-2 |
| EINECS | 253-049-7 |
| InChI | InChI=1/C11H14O3.Na/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9;/h4-7,12H,2-3,8H2,1H3;/q;+1/p-1 |
| Molecular Formula | C11H15NaO3 |
| Molar Mass | 218.23 |
| Melting Point | >220°C (dec.) |
| Boling Point | 309.2°C at 760 mmHg |
| Flash Point | 129.2°C |
| Solubility | Freely soluble in water and in ethanol (96%). |
| Vapor Presure | 0.000356mmHg at 25°C |
| Appearance | White powder |
| Color | White to Off-White |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Hygroscopic |
| MDL | MFCD00001758 |
| Physical and Chemical Properties | White hygroscopic powder. Soluble in water, alkaline. |
| Use | Widely used in medicine, food, textile industry and other fields such as anti-corrosion of cosmetics, feed, daily industrial products |
| use | widely used in medicine, food, textile industry and other fields such as cosmetics, feed, daily industrial products |